About N-[(E)-6-bicyclo[3.2.0]hept-3-enylideneamino]-2,4-dimethylbenzamide
N-[(E)-6-bicyclo[3.2.0]hept-3-enylideneamino]-2,4-dimethylbenzamide (PubChem CID 6064754) has the molecular formula C16H18N2O
and a molecular weight of 254.33 g/mol. Its IUPAC name is N-[(E)-6-bicyclo[3.2.0]hept-3-enylideneamino]-2,4-dimethylbenzamide.
Molecular Properties
| Compound Name | N-[(E)-6-bicyclo[3.2.0]hept-3-enylideneamino]-2,4-dimethylbenzamide |
| PubChem CID | 6064754 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | N-[(E)-6-bicyclo[3.2.0]hept-3-enylideneamino]-2,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)N/N=C2\CC3CC=CC23)c(C)c1 |
| InChI | InChI=1S/C16H18N2O/c1-10-6-7-13(11(2)8-10)16(19)18-17-15-9-12-4-3-5-14(12)15/h3,5-8,12,14H,4,9H2,1-2H3,(H,18,19)/b17-15+ |
| InChIKey | BVHBLKMOIIUOBU-BMRADRMJSA-N |
| XLogP | 2.99 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-6-bicyclo[3.2.0]hept-3-enylideneamino]-2,4-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-6-bicyclo[3.2.0]hept-3-enylideneamino]-2,4-dimethylbenzamide?
The IUPAC name of N-[(E)-6-bicyclo[3.2.0]hept-3-enylideneamino]-2,4-dimethylbenzamide (CID 6064754) is N-[(E)-6-bicyclo[3.2.0]hept-3-enylideneamino]-2,4-dimethylbenzamide.
What is the SMILES notation for N-[(E)-6-bicyclo[3.2.0]hept-3-enylideneamino]-2,4-dimethylbenzamide?
The canonical SMILES for N-[(E)-6-bicyclo[3.2.0]hept-3-enylideneamino]-2,4-dimethylbenzamide is Cc1ccc(C(=O)N/N=C2\CC3CC=CC23)c(C)c1.
What is the InChIKey of N-[(E)-6-bicyclo[3.2.0]hept-3-enylideneamino]-2,4-dimethylbenzamide?
The InChIKey is BVHBLKMOIIUOBU-BMRADRMJSA-N. The full InChI is InChI=1S/C16H18N2O/c1-10-6-7-13(11(2)8-10)16(19)18-17-15-9-12-4-3-5-14(12)15/h3,5-8,12,14H,4,9H2,1-2H3,(H,18,19)/b17-15+.
What are the key properties of N-[(E)-6-bicyclo[3.2.0]hept-3-enylideneamino]-2,4-dimethylbenzamide?
N-[(E)-6-bicyclo[3.2.0]hept-3-enylideneamino]-2,4-dimethylbenzamide has a molecular weight of 254.33 g/mol, XLogP of 2.99, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-6-bicyclo[3.2.0]hept-3-enylideneamino]-2,4-dimethylbenzamide is sourced from PubChem (CID 6064754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).