C11H19N3 — CID 60649512
N',N'-dimethyl-N-(2-pyridin-4-ylethyl)ethane-1,2-diamine (PubChem CID 60649512) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is N',N'-dimethyl-N-(2-pyridin-4-ylethyl)ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-(2-pyridin-4-ylethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 60649512 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | N',N'-dimethyl-N-(2-pyridin-4-ylethyl)ethane-1,2-diamine |
| SMILES | CN(C)CCNCCc1ccncc1 |
| InChI | InChI=1S/C11H19N3/c1-14(2)10-9-13-8-5-11-3-6-12-7-4-11/h3-4,6-7,13H,5,8-10H2,1-2H3 |
| InChIKey | QEQNKWIOBJICCS-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|