About 4-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-1H-pyrazol-5-amine
4-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-1H-pyrazol-5-amine (PubChem CID 60650205) has the molecular formula C12H8F2N4S
and a molecular weight of 278.29 g/mol. Its IUPAC name is 4-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-1H-pyrazol-5-amine.
Molecular Properties
| Compound Name | 4-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-1H-pyrazol-5-amine |
| PubChem CID | 60650205 |
| Molecular Formula | C12H8F2N4S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 4-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-1H-pyrazol-5-amine |
| SMILES | Nc1[nH]ncc1-c1nc(-c2ccc(F)c(F)c2)cs1 |
| InChI | InChI=1S/C12H8F2N4S/c13-8-2-1-6(3-9(8)14)10-5-19-12(17-10)7-4-16-18-11(7)15/h1-5H,(H3,15,16,18) |
| InChIKey | GWGDSFDDOLMFLE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrazole_amino_B(1)', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-1H-pyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-1H-pyrazol-5-amine?
The IUPAC name of 4-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-1H-pyrazol-5-amine (CID 60650205) is 4-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-1H-pyrazol-5-amine.
What is the SMILES notation for 4-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-1H-pyrazol-5-amine?
The canonical SMILES for 4-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-1H-pyrazol-5-amine is Nc1[nH]ncc1-c1nc(-c2ccc(F)c(F)c2)cs1.
What is the InChIKey of 4-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-1H-pyrazol-5-amine?
The InChIKey is GWGDSFDDOLMFLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F2N4S/c13-8-2-1-6(3-9(8)14)10-5-19-12(17-10)7-4-16-18-11(7)15/h1-5H,(H3,15,16,18).
What are the key properties of 4-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-1H-pyrazol-5-amine?
4-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-1H-pyrazol-5-amine has a molecular weight of 278.29 g/mol, XLogP of 3.06, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-1H-pyrazol-5-amine is sourced from PubChem (CID 60650205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).