About N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine
N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine (PubChem CID 606532) has the molecular formula C7H6N4O3
and a molecular weight of 194.15 g/mol. Its IUPAC name is N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine.
Molecular Properties
| Compound Name | N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine |
| PubChem CID | 606532 |
| Molecular Formula | C7H6N4O3 |
| Molecular Weight | 194.15 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine |
| SMILES | CNc1ccc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C7H6N4O3/c1-8-4-2-3-5(11(12)13)7-6(4)9-14-10-7/h2-3,8H,1H3 |
| InChIKey | UAPBYPSUWZVMRV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.15 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine?
The IUPAC name of N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine (CID 606532) is N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine.
What is the SMILES notation for N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine?
The canonical SMILES for N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine is CNc1ccc([N+](=O)[O-])c2nonc12.
What is the InChIKey of N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine?
The InChIKey is UAPBYPSUWZVMRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4O3/c1-8-4-2-3-5(11(12)13)7-6(4)9-14-10-7/h2-3,8H,1H3.
What are the key properties of N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine?
N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine has a molecular weight of 194.15 g/mol, XLogP of 1.17, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-4-nitro-2,1,3-benzoxadiazol-7-amine is sourced from PubChem (CID 606532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).