C15H23NO4 — CID 60653391
N,N-bis(2-hydroxyethyl)-2-(2-propan-2-ylphenoxy)acetamide (PubChem CID 60653391) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-2-(2-propan-2-ylphenoxy)acetamide.
| Compound Name | N,N-bis(2-hydroxyethyl)-2-(2-propan-2-ylphenoxy)acetamide |
|---|---|
| PubChem CID | 60653391 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-2-(2-propan-2-ylphenoxy)acetamide |
| SMILES | CC(C)c1ccccc1OCC(=O)N(CCO)CCO |
| InChI | InChI=1S/C15H23NO4/c1-12(2)13-5-3-4-6-14(13)20-11-15(19)16(7-9-17)8-10-18/h3-6,12,17-18H,7-11H2,1-2H3 |
| InChIKey | OBOGUANOWVKULF-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |