About N-(5-bromo-1,3-thiazol-2-yl)-2,4-dioxo-1H-pyrimidine-5-carboxamide
N-(5-bromo-1,3-thiazol-2-yl)-2,4-dioxo-1H-pyrimidine-5-carboxamide (PubChem CID 60654717) has the molecular formula C8H5BrN4O3S
and a molecular weight of 317.12 g/mol. Its IUPAC name is N-(5-bromo-1,3-thiazol-2-yl)-2,4-dioxo-1H-pyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | N-(5-bromo-1,3-thiazol-2-yl)-2,4-dioxo-1H-pyrimidine-5-carboxamide |
| PubChem CID | 60654717 |
| Molecular Formula | C8H5BrN4O3S |
| Molecular Weight | 317.12 g/mol |
| Exact Mass | 315.93 |
| IUPAC Name | N-(5-bromo-1,3-thiazol-2-yl)-2,4-dioxo-1H-pyrimidine-5-carboxamide |
| SMILES | O=C(Nc1ncc(Br)s1)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H5BrN4O3S/c9-4-2-11-8(17-4)13-6(15)3-1-10-7(16)12-5(3)14/h1-2H,(H,11,13,15)(H2,10,12,14,16) |
| InChIKey | QMCPQRGGVQSPKL-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.12 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(5-bromo-1,3-thiazol-2-yl)-2,4-dioxo-1H-pyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-bromo-1,3-thiazol-2-yl)-2,4-dioxo-1H-pyrimidine-5-carboxamide?
The IUPAC name of N-(5-bromo-1,3-thiazol-2-yl)-2,4-dioxo-1H-pyrimidine-5-carboxamide (CID 60654717) is N-(5-bromo-1,3-thiazol-2-yl)-2,4-dioxo-1H-pyrimidine-5-carboxamide.
What is the SMILES notation for N-(5-bromo-1,3-thiazol-2-yl)-2,4-dioxo-1H-pyrimidine-5-carboxamide?
The canonical SMILES for N-(5-bromo-1,3-thiazol-2-yl)-2,4-dioxo-1H-pyrimidine-5-carboxamide is O=C(Nc1ncc(Br)s1)c1c[nH]c(=O)[nH]c1=O.
What is the InChIKey of N-(5-bromo-1,3-thiazol-2-yl)-2,4-dioxo-1H-pyrimidine-5-carboxamide?
The InChIKey is QMCPQRGGVQSPKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrN4O3S/c9-4-2-11-8(17-4)13-6(15)3-1-10-7(16)12-5(3)14/h1-2H,(H,11,13,15)(H2,10,12,14,16).
What are the key properties of N-(5-bromo-1,3-thiazol-2-yl)-2,4-dioxo-1H-pyrimidine-5-carboxamide?
N-(5-bromo-1,3-thiazol-2-yl)-2,4-dioxo-1H-pyrimidine-5-carboxamide has a molecular weight of 317.12 g/mol, XLogP of 0.53, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-bromo-1,3-thiazol-2-yl)-2,4-dioxo-1H-pyrimidine-5-carboxamide is sourced from PubChem (CID 60654717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).