C14H9Cl2N3O2 — CID 60655081
5,6-dichloro-N-(2-methyl-1,3-benzoxazol-5-yl)pyridine-3-carboxamide (PubChem CID 60655081) has the molecular formula C14H9Cl2N3O2 and a molecular weight of 322.15 g/mol. Its IUPAC name is 5,6-dichloro-N-(2-methyl-1,3-benzoxazol-5-yl)pyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-(2-methyl-1,3-benzoxazol-5-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 60655081 |
| Molecular Formula | C14H9Cl2N3O2 |
| Molecular Weight | 322.15 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 5,6-dichloro-N-(2-methyl-1,3-benzoxazol-5-yl)pyridine-3-carboxamide |
| SMILES | Cc1nc2cc(NC(=O)c3cnc(Cl)c(Cl)c3)ccc2o1 |
| InChI | InChI=1S/C14H9Cl2N3O2/c1-7-18-11-5-9(2-3-12(11)21-7)19-14(20)8-4-10(15)13(16)17-6-8/h2-6H,1H3,(H,19,20) |
| InChIKey | NQQFGRLLOMOZBC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.15 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|