About 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-propylacetamide
2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-propylacetamide (PubChem CID 60656424) has the molecular formula C9H14N2O2S
and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-propylacetamide.
Molecular Properties
| Compound Name | 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-propylacetamide |
| PubChem CID | 60656424 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-propylacetamide |
| SMILES | CCCNC(=O)Cn1c(C)csc1=O |
| InChI | InChI=1S/C9H14N2O2S/c1-3-4-10-8(12)5-11-7(2)6-14-9(11)13/h6H,3-5H2,1-2H3,(H,10,12) |
| InChIKey | NFQDQVXCFBYIQH-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-propylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-propylacetamide?
The IUPAC name of 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-propylacetamide (CID 60656424) is 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-propylacetamide.
What is the SMILES notation for 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-propylacetamide?
The canonical SMILES for 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-propylacetamide is CCCNC(=O)Cn1c(C)csc1=O.
What is the InChIKey of 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-propylacetamide?
The InChIKey is NFQDQVXCFBYIQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2S/c1-3-4-10-8(12)5-11-7(2)6-14-9(11)13/h6H,3-5H2,1-2H3,(H,10,12).
What are the key properties of 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-propylacetamide?
2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-propylacetamide has a molecular weight of 214.29 g/mol, XLogP of 0.74, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-propylacetamide is sourced from PubChem (CID 60656424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).