About Levobetaxolol
Levobetaxolol (PubChem CID 60657) has the molecular formula C18H29NO3
and a molecular weight of 307.40 g/mol. Its IUPAC name is (2S)-1-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-3-(propan-2-ylamino)propan-2-ol.
Molecular Properties
| Compound Name | Levobetaxolol |
| PubChem CID | 60657 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | (2S)-1-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-3-(propan-2-ylamino)propan-2-ol |
| SMILES | CC(C)NC[C@@H](COC1=CC=C(C=C1)CCOCC2CC2)O |
| InChI | InChI=1S/C18H29NO3/c1-14(2)19-11-17(20)13-22-18-7-5-15(6-8-18)9-10-21-12-16-3-4-16/h5-8,14,16-17,19-20H,3-4,9-13H2,1-2H3/t17-/m0/s1 |
| InChIKey | NWIUTZDMDHAVTP-KRWDZBQOSA-N |
| XLogP | 2.80 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | 286 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze Levobetaxolol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Levobetaxolol?
The IUPAC name of Levobetaxolol (CID 60657) is (2S)-1-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-3-(propan-2-ylamino)propan-2-ol.
What is the SMILES notation for Levobetaxolol?
The canonical SMILES for Levobetaxolol is CC(C)NC[C@@H](COC1=CC=C(C=C1)CCOCC2CC2)O.
What is the InChIKey of Levobetaxolol?
The InChIKey is NWIUTZDMDHAVTP-KRWDZBQOSA-N. The full InChI is InChI=1S/C18H29NO3/c1-14(2)19-11-17(20)13-22-18-7-5-15(6-8-18)9-10-21-12-16-3-4-16/h5-8,14,16-17,19-20H,3-4,9-13H2,1-2H3/t17-/m0/s1.
What are the key properties of Levobetaxolol?
Levobetaxolol has a molecular weight of 307.40 g/mol, XLogP of 2.80, 11 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Levobetaxolol is sourced from PubChem (CID 60657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).