About N-[(3,4-difluorophenyl)methyl]-2,2-dimethoxyethanamine
N-[(3,4-difluorophenyl)methyl]-2,2-dimethoxyethanamine (PubChem CID 60657413) has the molecular formula C11H15F2NO2
and a molecular weight of 231.24 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]-2,2-dimethoxyethanamine.
Molecular Properties
| Compound Name | N-[(3,4-difluorophenyl)methyl]-2,2-dimethoxyethanamine |
| PubChem CID | 60657413 |
| Molecular Formula | C11H15F2NO2 |
| Molecular Weight | 231.24 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]-2,2-dimethoxyethanamine |
| SMILES | COC(CNCc1ccc(F)c(F)c1)OC |
| InChI | InChI=1S/C11H15F2NO2/c1-15-11(16-2)7-14-6-8-3-4-9(12)10(13)5-8/h3-5,11,14H,6-7H2,1-2H3 |
| InChIKey | SYVAUJZESLIARM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.24 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-[(3,4-difluorophenyl)methyl]-2,2-dimethoxyethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,4-difluorophenyl)methyl]-2,2-dimethoxyethanamine?
The IUPAC name of N-[(3,4-difluorophenyl)methyl]-2,2-dimethoxyethanamine (CID 60657413) is N-[(3,4-difluorophenyl)methyl]-2,2-dimethoxyethanamine.
What is the SMILES notation for N-[(3,4-difluorophenyl)methyl]-2,2-dimethoxyethanamine?
The canonical SMILES for N-[(3,4-difluorophenyl)methyl]-2,2-dimethoxyethanamine is COC(CNCc1ccc(F)c(F)c1)OC.
What is the InChIKey of N-[(3,4-difluorophenyl)methyl]-2,2-dimethoxyethanamine?
The InChIKey is SYVAUJZESLIARM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F2NO2/c1-15-11(16-2)7-14-6-8-3-4-9(12)10(13)5-8/h3-5,11,14H,6-7H2,1-2H3.
What are the key properties of N-[(3,4-difluorophenyl)methyl]-2,2-dimethoxyethanamine?
N-[(3,4-difluorophenyl)methyl]-2,2-dimethoxyethanamine has a molecular weight of 231.24 g/mol, XLogP of 1.67, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,4-difluorophenyl)methyl]-2,2-dimethoxyethanamine is sourced from PubChem (CID 60657413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).