C18H21ClN2 — CID 60657557
1-(3-chlorophenyl)-N-[(2-pyrrolidin-1-ylphenyl)methyl]methanamine (PubChem CID 60657557) has the molecular formula C18H21ClN2 and a molecular weight of 300.83 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-[(2-pyrrolidin-1-ylphenyl)methyl]methanamine.
| Compound Name | 1-(3-chlorophenyl)-N-[(2-pyrrolidin-1-ylphenyl)methyl]methanamine |
|---|---|
| PubChem CID | 60657557 |
| Molecular Formula | C18H21ClN2 |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 1-(3-chlorophenyl)-N-[(2-pyrrolidin-1-ylphenyl)methyl]methanamine |
| SMILES | Clc1cccc(CNCc2ccccc2N2CCCC2)c1 |
| InChI | InChI=1S/C18H21ClN2/c19-17-8-5-6-15(12-17)13-20-14-16-7-1-2-9-18(16)21-10-3-4-11-21/h1-2,5-9,12,20H,3-4,10-11,13-14H2 |
| InChIKey | MDUKDNLZWHQVEV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |