About ethyl 3-(4-methoxyphenyl)-1,3-thiazolidine-2-carboxylate
ethyl 3-(4-methoxyphenyl)-1,3-thiazolidine-2-carboxylate (PubChem CID 606585) has the molecular formula C13H17NO3S
and a molecular weight of 267.35 g/mol. Its IUPAC name is ethyl 3-(4-methoxyphenyl)-1,3-thiazolidine-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-(4-methoxyphenyl)-1,3-thiazolidine-2-carboxylate |
| PubChem CID | 606585 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | ethyl 3-(4-methoxyphenyl)-1,3-thiazolidine-2-carboxylate |
| SMILES | CCOC(=O)C1SCCN1c1ccc(OC)cc1 |
| InChI | InChI=1S/C13H17NO3S/c1-3-17-13(15)12-14(8-9-18-12)10-4-6-11(16-2)7-5-10/h4-7,12H,3,8-9H2,1-2H3 |
| InChIKey | QHTNRPQWGXWZIJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-(4-methoxyphenyl)-1,3-thiazolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(4-methoxyphenyl)-1,3-thiazolidine-2-carboxylate?
The IUPAC name of ethyl 3-(4-methoxyphenyl)-1,3-thiazolidine-2-carboxylate (CID 606585) is ethyl 3-(4-methoxyphenyl)-1,3-thiazolidine-2-carboxylate.
What is the SMILES notation for ethyl 3-(4-methoxyphenyl)-1,3-thiazolidine-2-carboxylate?
The canonical SMILES for ethyl 3-(4-methoxyphenyl)-1,3-thiazolidine-2-carboxylate is CCOC(=O)C1SCCN1c1ccc(OC)cc1.
What is the InChIKey of ethyl 3-(4-methoxyphenyl)-1,3-thiazolidine-2-carboxylate?
The InChIKey is QHTNRPQWGXWZIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3S/c1-3-17-13(15)12-14(8-9-18-12)10-4-6-11(16-2)7-5-10/h4-7,12H,3,8-9H2,1-2H3.
What are the key properties of ethyl 3-(4-methoxyphenyl)-1,3-thiazolidine-2-carboxylate?
ethyl 3-(4-methoxyphenyl)-1,3-thiazolidine-2-carboxylate has a molecular weight of 267.35 g/mol, XLogP of 2.14, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(4-methoxyphenyl)-1,3-thiazolidine-2-carboxylate is sourced from PubChem (CID 606585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).