C15H18N4O2 — CID 60658790
2,4-dimethyl-6-(1,2,3,4-tetrahydronaphthalen-2-ylamino)-1,2,4-triazine-3,5-dione (PubChem CID 60658790) has the molecular formula C15H18N4O2 and a molecular weight of 286.34 g/mol. Its IUPAC name is 2,4-dimethyl-6-(1,2,3,4-tetrahydronaphthalen-2-ylamino)-1,2,4-triazine-3,5-dione.
| Compound Name | 2,4-dimethyl-6-(1,2,3,4-tetrahydronaphthalen-2-ylamino)-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 60658790 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 2,4-dimethyl-6-(1,2,3,4-tetrahydronaphthalen-2-ylamino)-1,2,4-triazine-3,5-dione |
| SMILES | Cn1nc(NC2CCc3ccccc3C2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C15H18N4O2/c1-18-14(20)13(17-19(2)15(18)21)16-12-8-7-10-5-3-4-6-11(10)9-12/h3-6,12H,7-9H2,1-2H3,(H,16,17) |
| InChIKey | LORUUEGSCMJIFG-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |