C8H14N4O2S — CID 60658919
2,4-dimethyl-6-(2-methylsulfanylethylamino)-1,2,4-triazine-3,5-dione (PubChem CID 60658919) has the molecular formula C8H14N4O2S and a molecular weight of 230.29 g/mol. Its IUPAC name is 2,4-dimethyl-6-(2-methylsulfanylethylamino)-1,2,4-triazine-3,5-dione.
| Compound Name | 2,4-dimethyl-6-(2-methylsulfanylethylamino)-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 60658919 |
| Molecular Formula | C8H14N4O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 2,4-dimethyl-6-(2-methylsulfanylethylamino)-1,2,4-triazine-3,5-dione |
| SMILES | CSCCNc1nn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C8H14N4O2S/c1-11-7(13)6(9-4-5-15-3)10-12(2)8(11)14/h4-5H2,1-3H3,(H,9,10) |
| InChIKey | FSZUWQGLPHPQSY-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|