About N-(1-cyanocyclohexyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide
N-(1-cyanocyclohexyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 60660895) has the molecular formula C12H17N3O3S
and a molecular weight of 283.35 g/mol. Its IUPAC name is N-(1-cyanocyclohexyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-(1-cyanocyclohexyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| PubChem CID | 60660895 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | N-(1-cyanocyclohexyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)NC1(C#N)CCCCC1 |
| InChI | InChI=1S/C12H17N3O3S/c1-9-11(10(2)18-14-9)19(16,17)15-12(8-13)6-4-3-5-7-12/h15H,3-7H2,1-2H3 |
| InChIKey | PGMWHUJKTRLKQD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1-cyanocyclohexyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyanocyclohexyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide?
The IUPAC name of N-(1-cyanocyclohexyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide (CID 60660895) is N-(1-cyanocyclohexyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
What is the SMILES notation for N-(1-cyanocyclohexyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide?
The canonical SMILES for N-(1-cyanocyclohexyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide is Cc1noc(C)c1S(=O)(=O)NC1(C#N)CCCCC1.
What is the InChIKey of N-(1-cyanocyclohexyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide?
The InChIKey is PGMWHUJKTRLKQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O3S/c1-9-11(10(2)18-14-9)19(16,17)15-12(8-13)6-4-3-5-7-12/h15H,3-7H2,1-2H3.
What are the key properties of N-(1-cyanocyclohexyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide?
N-(1-cyanocyclohexyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide has a molecular weight of 283.35 g/mol, XLogP of 1.80, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyanocyclohexyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide is sourced from PubChem (CID 60660895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).