C7H13N3O4 — CID 60661713
methyl 3-[[2-(carbamoylamino)-2-oxoethyl]amino]propanoate (PubChem CID 60661713) has the molecular formula C7H13N3O4 and a molecular weight of 203.20 g/mol. Its IUPAC name is methyl 3-[[2-(carbamoylamino)-2-oxoethyl]amino]propanoate.
| Compound Name | methyl 3-[[2-(carbamoylamino)-2-oxoethyl]amino]propanoate |
|---|---|
| PubChem CID | 60661713 |
| Molecular Formula | C7H13N3O4 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | methyl 3-[[2-(carbamoylamino)-2-oxoethyl]amino]propanoate |
| SMILES | COC(=O)CCNCC(=O)NC(N)=O |
| InChI | InChI=1S/C7H13N3O4/c1-14-6(12)2-3-9-4-5(11)10-7(8)13/h9H,2-4H2,1H3,(H3,8,10,11,13) |
| InChIKey | CQXHPOZGSOBUIM-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|