About benzo[d][2]benzoxepine
benzo[d][2]benzoxepine (PubChem CID 606620) has the molecular formula C14H10O
and a molecular weight of 194.23 g/mol. Its IUPAC name is benzo[d][2]benzoxepine.
Molecular Properties
| Compound Name | benzo[d][2]benzoxepine |
| PubChem CID | 606620 |
| Molecular Formula | C14H10O |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | benzo[d][2]benzoxepine |
| SMILES | C1=c2ccccc2=c2ccccc2=CO1 |
| InChI | InChI=1S/C14H10O/c1-3-7-13-11(5-1)9-15-10-12-6-2-4-8-14(12)13/h1-10H |
| InChIKey | BGXLAWQGTYAERO-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzo[d][2]benzoxepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[d][2]benzoxepine?
The IUPAC name of benzo[d][2]benzoxepine (CID 606620) is benzo[d][2]benzoxepine.
What is the SMILES notation for benzo[d][2]benzoxepine?
The canonical SMILES for benzo[d][2]benzoxepine is C1=c2ccccc2=c2ccccc2=CO1.
What is the InChIKey of benzo[d][2]benzoxepine?
The InChIKey is BGXLAWQGTYAERO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O/c1-3-7-13-11(5-1)9-15-10-12-6-2-4-8-14(12)13/h1-10H.
What are the key properties of benzo[d][2]benzoxepine?
benzo[d][2]benzoxepine has a molecular weight of 194.23 g/mol, XLogP of 1.48, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[d][2]benzoxepine is sourced from PubChem (CID 606620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).