C16H29NO3 — CID 60662129
1-[2-[butan-2-yl(butyl)amino]-2-oxoethyl]cyclopentane-1-carboxylic acid (PubChem CID 60662129) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is 1-[2-[butan-2-yl(butyl)amino]-2-oxoethyl]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[2-[butan-2-yl(butyl)amino]-2-oxoethyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 60662129 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | 1-[2-[butan-2-yl(butyl)amino]-2-oxoethyl]cyclopentane-1-carboxylic acid |
| SMILES | CCCCN(C(=O)CC1(C(=O)O)CCCC1)C(C)CC |
| InChI | InChI=1S/C16H29NO3/c1-4-6-11-17(13(3)5-2)14(18)12-16(15(19)20)9-7-8-10-16/h13H,4-12H2,1-3H3,(H,19,20) |
| InChIKey | JFZDMLFXKQTRAD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |