C12H15NO5S — CID 60662818
6-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 60662818) has the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. Its IUPAC name is 6-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 60662818 |
| Molecular Formula | C12H15NO5S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 6-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)C1CC=CCC1C(=O)NC1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C12H15NO5S/c14-11(13-8-5-6-19(17,18)7-8)9-3-1-2-4-10(9)12(15)16/h1-2,5-6,8-10H,3-4,7H2,(H,13,14)(H,15,16) |
| InChIKey | IXJIIBMVNDXMJU-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|