About 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-propan-2-ylbutanamide
4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-propan-2-ylbutanamide (PubChem CID 60664933) has the molecular formula C11H18N2O2S
and a molecular weight of 242.34 g/mol. Its IUPAC name is 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-propan-2-ylbutanamide.
Molecular Properties
| Compound Name | 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-propan-2-ylbutanamide |
| PubChem CID | 60664933 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-propan-2-ylbutanamide |
| SMILES | Cc1csc(=O)n1CCCC(=O)NC(C)C |
| InChI | InChI=1S/C11H18N2O2S/c1-8(2)12-10(14)5-4-6-13-9(3)7-16-11(13)15/h7-8H,4-6H2,1-3H3,(H,12,14) |
| InChIKey | JVFZSUQCSQMASL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-propan-2-ylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-propan-2-ylbutanamide?
The IUPAC name of 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-propan-2-ylbutanamide (CID 60664933) is 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-propan-2-ylbutanamide.
What is the SMILES notation for 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-propan-2-ylbutanamide?
The canonical SMILES for 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-propan-2-ylbutanamide is Cc1csc(=O)n1CCCC(=O)NC(C)C.
What is the InChIKey of 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-propan-2-ylbutanamide?
The InChIKey is JVFZSUQCSQMASL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2S/c1-8(2)12-10(14)5-4-6-13-9(3)7-16-11(13)15/h7-8H,4-6H2,1-3H3,(H,12,14).
What are the key properties of 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-propan-2-ylbutanamide?
4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-propan-2-ylbutanamide has a molecular weight of 242.34 g/mol, XLogP of 1.52, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-propan-2-ylbutanamide is sourced from PubChem (CID 60664933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).