About 1-phenylbenzimidazole
1-phenylbenzimidazole (PubChem CID 606669) has the molecular formula C13H10N2
and a molecular weight of 194.24 g/mol. Its IUPAC name is 1-phenylbenzimidazole.
Molecular Properties
| Compound Name | 1-phenylbenzimidazole |
| PubChem CID | 606669 |
| Molecular Formula | C13H10N2 |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 1-phenylbenzimidazole |
| SMILES | c1ccc(-n2cnc3ccccc32)cc1 |
| InChI | InChI=1S/C13H10N2/c1-2-6-11(7-3-1)15-10-14-12-8-4-5-9-13(12)15/h1-10H |
| InChIKey | XNCMQRWVMWLODV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-phenylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylbenzimidazole?
The IUPAC name of 1-phenylbenzimidazole (CID 606669) is 1-phenylbenzimidazole.
What is the SMILES notation for 1-phenylbenzimidazole?
The canonical SMILES for 1-phenylbenzimidazole is c1ccc(-n2cnc3ccccc32)cc1.
What is the InChIKey of 1-phenylbenzimidazole?
The InChIKey is XNCMQRWVMWLODV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2/c1-2-6-11(7-3-1)15-10-14-12-8-4-5-9-13(12)15/h1-10H.
What are the key properties of 1-phenylbenzimidazole?
1-phenylbenzimidazole has a molecular weight of 194.24 g/mol, XLogP of 3.03, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylbenzimidazole is sourced from PubChem (CID 606669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).