About 1-methylphenazine
1-methylphenazine (PubChem CID 606676) has the molecular formula C13H10N2
and a molecular weight of 194.24 g/mol. Its IUPAC name is 1-methylphenazine.
Molecular Properties
| Compound Name | 1-methylphenazine |
| PubChem CID | 606676 |
| Molecular Formula | C13H10N2 |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 1-methylphenazine |
| SMILES | Cc1cccc2nc3ccccc3nc12 |
| InChI | InChI=1S/C13H10N2/c1-9-5-4-8-12-13(9)15-11-7-3-2-6-10(11)14-12/h2-8H,1H3 |
| InChIKey | WBVSERCLMQZOBK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1-methylphenazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylphenazine?
The IUPAC name of 1-methylphenazine (CID 606676) is 1-methylphenazine.
What is the SMILES notation for 1-methylphenazine?
The canonical SMILES for 1-methylphenazine is Cc1cccc2nc3ccccc3nc12.
What is the InChIKey of 1-methylphenazine?
The InChIKey is WBVSERCLMQZOBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2/c1-9-5-4-8-12-13(9)15-11-7-3-2-6-10(11)14-12/h2-8H,1H3.
What are the key properties of 1-methylphenazine?
1-methylphenazine has a molecular weight of 194.24 g/mol, XLogP of 3.09, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylphenazine is sourced from PubChem (CID 606676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).