C11H15NOS — CID 60667675
N-ethyl-3-(methylsulfanylmethyl)benzamide (PubChem CID 60667675) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is N-ethyl-3-(methylsulfanylmethyl)benzamide.
| Compound Name | N-ethyl-3-(methylsulfanylmethyl)benzamide |
|---|---|
| PubChem CID | 60667675 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | N-ethyl-3-(methylsulfanylmethyl)benzamide |
| SMILES | CCNC(=O)c1cccc(CSC)c1 |
| InChI | InChI=1S/C11H15NOS/c1-3-12-11(13)10-6-4-5-9(7-10)8-14-2/h4-7H,3,8H2,1-2H3,(H,12,13) |
| InChIKey | CHHHYMLNIYLUCD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |