About ethyl 4-[4-(4-methyl-2-oxo-1,3-thiazol-3-yl)butanoylamino]butanoate
ethyl 4-[4-(4-methyl-2-oxo-1,3-thiazol-3-yl)butanoylamino]butanoate (PubChem CID 60667777) has the molecular formula C14H22N2O4S
and a molecular weight of 314.41 g/mol. Its IUPAC name is ethyl 4-[4-(4-methyl-2-oxo-1,3-thiazol-3-yl)butanoylamino]butanoate.
Molecular Properties
| Compound Name | ethyl 4-[4-(4-methyl-2-oxo-1,3-thiazol-3-yl)butanoylamino]butanoate |
| PubChem CID | 60667777 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | ethyl 4-[4-(4-methyl-2-oxo-1,3-thiazol-3-yl)butanoylamino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)CCCn1c(C)csc1=O |
| InChI | InChI=1S/C14H22N2O4S/c1-3-20-13(18)7-4-8-15-12(17)6-5-9-16-11(2)10-21-14(16)19/h10H,3-9H2,1-2H3,(H,15,17) |
| InChIKey | OCWOIRQHKYAFSI-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[4-(4-methyl-2-oxo-1,3-thiazol-3-yl)butanoylamino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[4-(4-methyl-2-oxo-1,3-thiazol-3-yl)butanoylamino]butanoate?
The IUPAC name of ethyl 4-[4-(4-methyl-2-oxo-1,3-thiazol-3-yl)butanoylamino]butanoate (CID 60667777) is ethyl 4-[4-(4-methyl-2-oxo-1,3-thiazol-3-yl)butanoylamino]butanoate.
What is the SMILES notation for ethyl 4-[4-(4-methyl-2-oxo-1,3-thiazol-3-yl)butanoylamino]butanoate?
The canonical SMILES for ethyl 4-[4-(4-methyl-2-oxo-1,3-thiazol-3-yl)butanoylamino]butanoate is CCOC(=O)CCCNC(=O)CCCn1c(C)csc1=O.
What is the InChIKey of ethyl 4-[4-(4-methyl-2-oxo-1,3-thiazol-3-yl)butanoylamino]butanoate?
The InChIKey is OCWOIRQHKYAFSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O4S/c1-3-20-13(18)7-4-8-15-12(17)6-5-9-16-11(2)10-21-14(16)19/h10H,3-9H2,1-2H3,(H,15,17).
What are the key properties of ethyl 4-[4-(4-methyl-2-oxo-1,3-thiazol-3-yl)butanoylamino]butanoate?
ethyl 4-[4-(4-methyl-2-oxo-1,3-thiazol-3-yl)butanoylamino]butanoate has a molecular weight of 314.41 g/mol, XLogP of 1.46, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[4-(4-methyl-2-oxo-1,3-thiazol-3-yl)butanoylamino]butanoate is sourced from PubChem (CID 60667777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).