C12H14N4O4S — CID 60668873
2-oxo-N-[1-(4-sulfamoylphenyl)ethyl]-1,3-dihydroimidazole-4-carboxamide (PubChem CID 60668873) has the molecular formula C12H14N4O4S and a molecular weight of 310.34 g/mol. Its IUPAC name is 2-oxo-N-[1-(4-sulfamoylphenyl)ethyl]-1,3-dihydroimidazole-4-carboxamide.
| Compound Name | 2-oxo-N-[1-(4-sulfamoylphenyl)ethyl]-1,3-dihydroimidazole-4-carboxamide |
|---|---|
| PubChem CID | 60668873 |
| Molecular Formula | C12H14N4O4S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 2-oxo-N-[1-(4-sulfamoylphenyl)ethyl]-1,3-dihydroimidazole-4-carboxamide |
| SMILES | CC(NC(=O)c1c[nH]c(=O)[nH]1)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C12H14N4O4S/c1-7(15-11(17)10-6-14-12(18)16-10)8-2-4-9(5-3-8)21(13,19)20/h2-7H,1H3,(H,15,17)(H2,13,19,20)(H2,14,16,18) |
| InChIKey | VEEQPTZVVVNWQP-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 137.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |