C16H32N2O2 — CID 60670027
N,N-dibutyl-2-[3-(hydroxymethyl)piperidin-1-yl]acetamide (PubChem CID 60670027) has the molecular formula C16H32N2O2 and a molecular weight of 284.44 g/mol. Its IUPAC name is N,N-dibutyl-2-[3-(hydroxymethyl)piperidin-1-yl]acetamide.
| Compound Name | N,N-dibutyl-2-[3-(hydroxymethyl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 60670027 |
| Molecular Formula | C16H32N2O2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | N,N-dibutyl-2-[3-(hydroxymethyl)piperidin-1-yl]acetamide |
| SMILES | CCCCN(CCCC)C(=O)CN1CCCC(CO)C1 |
| InChI | InChI=1S/C16H32N2O2/c1-3-5-10-18(11-6-4-2)16(20)13-17-9-7-8-15(12-17)14-19/h15,19H,3-14H2,1-2H3 |
| InChIKey | KTPYBLWVZLIVMX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |