About 4-(2,4-dimethylphenyl)sulfanyl-1,1-dioxothiolan-3-ol
4-(2,4-dimethylphenyl)sulfanyl-1,1-dioxothiolan-3-ol (PubChem CID 60670896) has the molecular formula C12H16O3S2
and a molecular weight of 272.39 g/mol. Its IUPAC name is 4-(2,4-dimethylphenyl)sulfanyl-1,1-dioxothiolan-3-ol.
Molecular Properties
| Compound Name | 4-(2,4-dimethylphenyl)sulfanyl-1,1-dioxothiolan-3-ol |
| PubChem CID | 60670896 |
| Molecular Formula | C12H16O3S2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 4-(2,4-dimethylphenyl)sulfanyl-1,1-dioxothiolan-3-ol |
| SMILES | Cc1ccc(SC2CS(=O)(=O)CC2O)c(C)c1 |
| InChI | InChI=1S/C12H16O3S2/c1-8-3-4-11(9(2)5-8)16-12-7-17(14,15)6-10(12)13/h3-5,10,12-13H,6-7H2,1-2H3 |
| InChIKey | WRKROANWPBYUJP-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2,4-dimethylphenyl)sulfanyl-1,1-dioxothiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-dimethylphenyl)sulfanyl-1,1-dioxothiolan-3-ol?
The IUPAC name of 4-(2,4-dimethylphenyl)sulfanyl-1,1-dioxothiolan-3-ol (CID 60670896) is 4-(2,4-dimethylphenyl)sulfanyl-1,1-dioxothiolan-3-ol.
What is the SMILES notation for 4-(2,4-dimethylphenyl)sulfanyl-1,1-dioxothiolan-3-ol?
The canonical SMILES for 4-(2,4-dimethylphenyl)sulfanyl-1,1-dioxothiolan-3-ol is Cc1ccc(SC2CS(=O)(=O)CC2O)c(C)c1.
What is the InChIKey of 4-(2,4-dimethylphenyl)sulfanyl-1,1-dioxothiolan-3-ol?
The InChIKey is WRKROANWPBYUJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3S2/c1-8-3-4-11(9(2)5-8)16-12-7-17(14,15)6-10(12)13/h3-5,10,12-13H,6-7H2,1-2H3.
What are the key properties of 4-(2,4-dimethylphenyl)sulfanyl-1,1-dioxothiolan-3-ol?
4-(2,4-dimethylphenyl)sulfanyl-1,1-dioxothiolan-3-ol has a molecular weight of 272.39 g/mol, XLogP of 1.55, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dimethylphenyl)sulfanyl-1,1-dioxothiolan-3-ol is sourced from PubChem (CID 60670896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).