ethyl 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanoate

C9H15N3O2S — CID 60670953

IUPACethyl 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanoate
SMILESCCOC(=O)CCSc1nnc(C)n1C
InChIInChI=1S/C9H15N3O2S/c1-4-14-8(13)5-6-15-9-11-10-7(2)12(9)3/h4-6H2,1-3H3
InChIKeyKWCMQTHXFFKCLD-UHFFFAOYSA-N
MW229.30 g/mol
LogP1.17
Rot. Bonds5

About ethyl 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanoate

ethyl 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanoate (PubChem CID 60670953) has the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. Its IUPAC name is ethyl 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanoate.

Molecular Properties

Compound Nameethyl 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanoate
PubChem CID60670953
Molecular FormulaC9H15N3O2S
Molecular Weight229.30 g/mol
Exact Mass229.09
IUPAC Nameethyl 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanoate
SMILESCCOC(=O)CCSc1nnc(C)n1C
InChIInChI=1S/C9H15N3O2S/c1-4-14-8(13)5-6-15-9-11-10-7(2)12(9)3/h4-6H2,1-3H3
InChIKeyKWCMQTHXFFKCLD-UHFFFAOYSA-N
XLogP1.17
TPSA57.01 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.30
LogP ≤ 51.17
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze ethyl 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanoate?
The IUPAC name of ethyl 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanoate (CID 60670953) is ethyl 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanoate.
What is the SMILES notation for ethyl 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanoate?
The canonical SMILES for ethyl 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanoate is CCOC(=O)CCSc1nnc(C)n1C.
What is the InChIKey of ethyl 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanoate?
The InChIKey is KWCMQTHXFFKCLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2S/c1-4-14-8(13)5-6-15-9-11-10-7(2)12(9)3/h4-6H2,1-3H3.
What are the key properties of ethyl 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanoate?
ethyl 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanoate has a molecular weight of 229.30 g/mol, XLogP of 1.17, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanoate is sourced from PubChem (CID 60670953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).