C19H11Cl2F3N2O3 — CID 6067297
[(Z)-[amino-(4-chlorophenyl)methylidene]amino] 5-(4-chlorophenyl)-2-(trifluoromethyl)furan-3-carboxylate (PubChem CID 6067297) has the molecular formula C19H11Cl2F3N2O3 and a molecular weight of 443.21 g/mol. Its IUPAC name is [(Z)-[amino-(4-chlorophenyl)methylidene]amino] 5-(4-chlorophenyl)-2-(trifluoromethyl)furan-3-carboxylate.
| Compound Name | [(Z)-[amino-(4-chlorophenyl)methylidene]amino] 5-(4-chlorophenyl)-2-(trifluoromethyl)furan-3-carboxylate |
|---|---|
| PubChem CID | 6067297 |
| Molecular Formula | C19H11Cl2F3N2O3 |
| Molecular Weight | 443.21 g/mol |
| Exact Mass | 442.01 |
| IUPAC Name | [(Z)-[amino-(4-chlorophenyl)methylidene]amino] 5-(4-chlorophenyl)-2-(trifluoromethyl)furan-3-carboxylate |
| SMILES | N/C(=N\OC(=O)c1cc(-c2ccc(Cl)cc2)oc1C(F)(F)F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H11Cl2F3N2O3/c20-12-5-1-10(2-6-12)15-9-14(16(28-15)19(22,23)24)18(27)29-26-17(25)11-3-7-13(21)8-4-11/h1-9H,(H2,25,26) |
| InChIKey | JDTKQDUEAOPONH-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.21 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|