C11H16FNO — CID 60674294
3-[(2-fluorophenyl)methyl-methylamino]propan-1-ol (PubChem CID 60674294) has the molecular formula C11H16FNO and a molecular weight of 197.25 g/mol. Its IUPAC name is 3-[(2-fluorophenyl)methyl-methylamino]propan-1-ol.
| Compound Name | 3-[(2-fluorophenyl)methyl-methylamino]propan-1-ol |
|---|---|
| PubChem CID | 60674294 |
| Molecular Formula | C11H16FNO |
| Molecular Weight | 197.25 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 3-[(2-fluorophenyl)methyl-methylamino]propan-1-ol |
| SMILES | CN(CCCO)Cc1ccccc1F |
| InChI | InChI=1S/C11H16FNO/c1-13(7-4-8-14)9-10-5-2-3-6-11(10)12/h2-3,5-6,14H,4,7-9H2,1H3 |
| InChIKey | NMVCKLWLJLJSGJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |