About (4-methylcyclohexyl) 5-chloro-2-fluorobenzoate
(4-methylcyclohexyl) 5-chloro-2-fluorobenzoate (PubChem CID 60674778) has the molecular formula C14H16ClFO2
and a molecular weight of 270.73 g/mol. Its IUPAC name is (4-methylcyclohexyl) 5-chloro-2-fluorobenzoate.
Molecular Properties
| Compound Name | (4-methylcyclohexyl) 5-chloro-2-fluorobenzoate |
| PubChem CID | 60674778 |
| Molecular Formula | C14H16ClFO2 |
| Molecular Weight | 270.73 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | (4-methylcyclohexyl) 5-chloro-2-fluorobenzoate |
| SMILES | CC1CCC(OC(=O)c2cc(Cl)ccc2F)CC1 |
| InChI | InChI=1S/C14H16ClFO2/c1-9-2-5-11(6-3-9)18-14(17)12-8-10(15)4-7-13(12)16/h4,7-9,11H,2-3,5-6H2,1H3 |
| InChIKey | NVCCPIYCLQXWJB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.73 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-methylcyclohexyl) 5-chloro-2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylcyclohexyl) 5-chloro-2-fluorobenzoate?
The IUPAC name of (4-methylcyclohexyl) 5-chloro-2-fluorobenzoate (CID 60674778) is (4-methylcyclohexyl) 5-chloro-2-fluorobenzoate.
What is the SMILES notation for (4-methylcyclohexyl) 5-chloro-2-fluorobenzoate?
The canonical SMILES for (4-methylcyclohexyl) 5-chloro-2-fluorobenzoate is CC1CCC(OC(=O)c2cc(Cl)ccc2F)CC1.
What is the InChIKey of (4-methylcyclohexyl) 5-chloro-2-fluorobenzoate?
The InChIKey is NVCCPIYCLQXWJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClFO2/c1-9-2-5-11(6-3-9)18-14(17)12-8-10(15)4-7-13(12)16/h4,7-9,11H,2-3,5-6H2,1H3.
What are the key properties of (4-methylcyclohexyl) 5-chloro-2-fluorobenzoate?
(4-methylcyclohexyl) 5-chloro-2-fluorobenzoate has a molecular weight of 270.73 g/mol, XLogP of 4.21, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylcyclohexyl) 5-chloro-2-fluorobenzoate is sourced from PubChem (CID 60674778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).