About 6-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)pyridazin-3-amine
6-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)pyridazin-3-amine (PubChem CID 60674953) has the molecular formula C8H8ClN3O2S
and a molecular weight of 245.69 g/mol. Its IUPAC name is 6-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)pyridazin-3-amine.
Molecular Properties
| Compound Name | 6-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)pyridazin-3-amine |
| PubChem CID | 60674953 |
| Molecular Formula | C8H8ClN3O2S |
| Molecular Weight | 245.69 g/mol |
| Exact Mass | 245.00 |
| IUPAC Name | 6-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)pyridazin-3-amine |
| SMILES | O=S1(=O)C=CC(Nc2ccc(Cl)nn2)C1 |
| InChI | InChI=1S/C8H8ClN3O2S/c9-7-1-2-8(12-11-7)10-6-3-4-15(13,14)5-6/h1-4,6H,5H2,(H,10,12) |
| InChIKey | WXWLJLLCCFTMDZ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.69 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)pyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)pyridazin-3-amine?
The IUPAC name of 6-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)pyridazin-3-amine (CID 60674953) is 6-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)pyridazin-3-amine.
What is the SMILES notation for 6-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)pyridazin-3-amine?
The canonical SMILES for 6-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)pyridazin-3-amine is O=S1(=O)C=CC(Nc2ccc(Cl)nn2)C1.
What is the InChIKey of 6-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)pyridazin-3-amine?
The InChIKey is WXWLJLLCCFTMDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClN3O2S/c9-7-1-2-8(12-11-7)10-6-3-4-15(13,14)5-6/h1-4,6H,5H2,(H,10,12).
What are the key properties of 6-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)pyridazin-3-amine?
6-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)pyridazin-3-amine has a molecular weight of 245.69 g/mol, XLogP of 0.85, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)pyridazin-3-amine is sourced from PubChem (CID 60674953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).