About N,N-dimethyl-1,1-dioxothiolane-3-carboxamide
N,N-dimethyl-1,1-dioxothiolane-3-carboxamide (PubChem CID 60675585) has the molecular formula C7H13NO3S
and a molecular weight of 191.25 g/mol. Its IUPAC name is N,N-dimethyl-1,1-dioxothiolane-3-carboxamide.
Molecular Properties
| Compound Name | N,N-dimethyl-1,1-dioxothiolane-3-carboxamide |
| PubChem CID | 60675585 |
| Molecular Formula | C7H13NO3S |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | N,N-dimethyl-1,1-dioxothiolane-3-carboxamide |
| SMILES | CN(C)C(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H13NO3S/c1-8(2)7(9)6-3-4-12(10,11)5-6/h6H,3-5H2,1-2H3 |
| InChIKey | IHMBQKYVVHKPTA-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-dimethyl-1,1-dioxothiolane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-1,1-dioxothiolane-3-carboxamide?
The IUPAC name of N,N-dimethyl-1,1-dioxothiolane-3-carboxamide (CID 60675585) is N,N-dimethyl-1,1-dioxothiolane-3-carboxamide.
What is the SMILES notation for N,N-dimethyl-1,1-dioxothiolane-3-carboxamide?
The canonical SMILES for N,N-dimethyl-1,1-dioxothiolane-3-carboxamide is CN(C)C(=O)C1CCS(=O)(=O)C1.
What is the InChIKey of N,N-dimethyl-1,1-dioxothiolane-3-carboxamide?
The InChIKey is IHMBQKYVVHKPTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO3S/c1-8(2)7(9)6-3-4-12(10,11)5-6/h6H,3-5H2,1-2H3.
What are the key properties of N,N-dimethyl-1,1-dioxothiolane-3-carboxamide?
N,N-dimethyl-1,1-dioxothiolane-3-carboxamide has a molecular weight of 191.25 g/mol, XLogP of -0.49, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-1,1-dioxothiolane-3-carboxamide is sourced from PubChem (CID 60675585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).