About 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N,N-diethylacetamide
2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N,N-diethylacetamide (PubChem CID 60675927) has the molecular formula C12H19N3O2
and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N,N-diethylacetamide.
Molecular Properties
| Compound Name | 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N,N-diethylacetamide |
| PubChem CID | 60675927 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)Cc1c(C)nc(=O)[nH]c1C |
| InChI | InChI=1S/C12H19N3O2/c1-5-15(6-2)11(16)7-10-8(3)13-12(17)14-9(10)4/h5-7H2,1-4H3,(H,13,14,17) |
| InChIKey | BVXCNROJVIZULG-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N,N-diethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N,N-diethylacetamide?
The IUPAC name of 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N,N-diethylacetamide (CID 60675927) is 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N,N-diethylacetamide.
What is the SMILES notation for 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N,N-diethylacetamide?
The canonical SMILES for 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N,N-diethylacetamide is CCN(CC)C(=O)Cc1c(C)nc(=O)[nH]c1C.
What is the InChIKey of 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N,N-diethylacetamide?
The InChIKey is BVXCNROJVIZULG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O2/c1-5-15(6-2)11(16)7-10-8(3)13-12(17)14-9(10)4/h5-7H2,1-4H3,(H,13,14,17).
What are the key properties of 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N,N-diethylacetamide?
2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N,N-diethylacetamide has a molecular weight of 237.30 g/mol, XLogP of 0.80, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N,N-diethylacetamide is sourced from PubChem (CID 60675927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).