C22H24ClN3O2 — CID 60676
Serazapine Hydrochloride (PubChem CID 60676) has the molecular formula C22H24ClN3O2 and a molecular weight of 397.90 g/mol. Its IUPAC name is methyl 4-methyl-4,7,15-triazapentacyclo[13.7.0.02,7.08,13.016,21]docosa-1(22),8,10,12,16,18,20-heptaene-22-carboxylate;hydrochloride.
| Compound Name | Serazapine Hydrochloride |
|---|---|
| PubChem CID | 60676 |
| Molecular Formula | C22H24ClN3O2 |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | methyl 4-methyl-4,7,15-triazapentacyclo[13.7.0.02,7.08,13.016,21]docosa-1(22),8,10,12,16,18,20-heptaene-22-carboxylate;hydrochloride |
| SMILES | CN1CCN2C(C1)C3=C(C4=CC=CC=C4N3CC5=CC=CC=C52)C(=O)OC.Cl |
| InChI | InChI=1S/C22H23N3O2.ClH/c1-23-11-12-24-17-9-5-3-7-15(17)13-25-18-10-6-4-8-16(18)20(22(26)27-2)21(25)19(24)14-23;/h3-10,19H,11-14H2,1-2H3;1H |
| InChIKey | YEITZTKANLXOTH-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 37.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | 570 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |