C13H5Cl4NO — CID 60677682
2-chloro-6-(2,4,5-trichlorophenoxy)benzonitrile (PubChem CID 60677682) has the molecular formula C13H5Cl4NO and a molecular weight of 333.00 g/mol. Its IUPAC name is 2-chloro-6-(2,4,5-trichlorophenoxy)benzonitrile.
| Compound Name | 2-chloro-6-(2,4,5-trichlorophenoxy)benzonitrile |
|---|---|
| PubChem CID | 60677682 |
| Molecular Formula | C13H5Cl4NO |
| Molecular Weight | 333.00 g/mol |
| Exact Mass | 330.91 |
| IUPAC Name | 2-chloro-6-(2,4,5-trichlorophenoxy)benzonitrile |
| SMILES | N#Cc1c(Cl)cccc1Oc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H5Cl4NO/c14-8-2-1-3-12(7(8)6-18)19-13-5-10(16)9(15)4-11(13)17/h1-5H |
| InChIKey | RVQFXKCBSLGAEQ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.00 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|