About 2-[(4-amino-1-methyl-2,6-dioxo-3-propylpyrimidin-5-yl)amino]-N-methylacetamide
2-[(4-amino-1-methyl-2,6-dioxo-3-propylpyrimidin-5-yl)amino]-N-methylacetamide (PubChem CID 60677988) has the molecular formula C11H19N5O3
and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-[(4-amino-1-methyl-2,6-dioxo-3-propylpyrimidin-5-yl)amino]-N-methylacetamide.
Molecular Properties
| Compound Name | 2-[(4-amino-1-methyl-2,6-dioxo-3-propylpyrimidin-5-yl)amino]-N-methylacetamide |
| PubChem CID | 60677988 |
| Molecular Formula | C11H19N5O3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 2-[(4-amino-1-methyl-2,6-dioxo-3-propylpyrimidin-5-yl)amino]-N-methylacetamide |
| SMILES | CCCn1c(N)c(NCC(=O)NC)c(=O)n(C)c1=O |
| InChI | InChI=1S/C11H19N5O3/c1-4-5-16-9(12)8(14-6-7(17)13-2)10(18)15(3)11(16)19/h14H,4-6,12H2,1-3H3,(H,13,17) |
| InChIKey | KNTAPCMFAGDWBY-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[(4-amino-1-methyl-2,6-dioxo-3-propylpyrimidin-5-yl)amino]-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-amino-1-methyl-2,6-dioxo-3-propylpyrimidin-5-yl)amino]-N-methylacetamide?
The IUPAC name of 2-[(4-amino-1-methyl-2,6-dioxo-3-propylpyrimidin-5-yl)amino]-N-methylacetamide (CID 60677988) is 2-[(4-amino-1-methyl-2,6-dioxo-3-propylpyrimidin-5-yl)amino]-N-methylacetamide.
What is the SMILES notation for 2-[(4-amino-1-methyl-2,6-dioxo-3-propylpyrimidin-5-yl)amino]-N-methylacetamide?
The canonical SMILES for 2-[(4-amino-1-methyl-2,6-dioxo-3-propylpyrimidin-5-yl)amino]-N-methylacetamide is CCCn1c(N)c(NCC(=O)NC)c(=O)n(C)c1=O.
What is the InChIKey of 2-[(4-amino-1-methyl-2,6-dioxo-3-propylpyrimidin-5-yl)amino]-N-methylacetamide?
The InChIKey is KNTAPCMFAGDWBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N5O3/c1-4-5-16-9(12)8(14-6-7(17)13-2)10(18)15(3)11(16)19/h14H,4-6,12H2,1-3H3,(H,13,17).
What are the key properties of 2-[(4-amino-1-methyl-2,6-dioxo-3-propylpyrimidin-5-yl)amino]-N-methylacetamide?
2-[(4-amino-1-methyl-2,6-dioxo-3-propylpyrimidin-5-yl)amino]-N-methylacetamide has a molecular weight of 269.30 g/mol, XLogP of -1.30, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-amino-1-methyl-2,6-dioxo-3-propylpyrimidin-5-yl)amino]-N-methylacetamide is sourced from PubChem (CID 60677988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).