C11H18N2O — CID 60678242
1-cyano-N,N-diethylcyclopentane-1-carboxamide (PubChem CID 60678242) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-cyano-N,N-diethylcyclopentane-1-carboxamide.
| Compound Name | 1-cyano-N,N-diethylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 60678242 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 1-cyano-N,N-diethylcyclopentane-1-carboxamide |
| SMILES | CCN(CC)C(=O)C1(C#N)CCCC1 |
| InChI | InChI=1S/C11H18N2O/c1-3-13(4-2)10(14)11(9-12)7-5-6-8-11/h3-8H2,1-2H3 |
| InChIKey | WSFMCCYQNDNUFJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |