4,6-dimethyl-2-(propylamino)pyridine-3-carboxylic acid

C11H16N2O2 — CID 60678505

IUPAC4,6-dimethyl-2-(propylamino)pyridine-3-carboxylic acid
SMILESCCCNc1nc(C)cc(C)c1C(=O)O
InChIInChI=1S/C11H16N2O2/c1-4-5-12-10-9(11(14)15)7(2)6-8(3)13-10/h6H,4-5H2,1-3H3,(H,12,13)(H,14,15)
InChIKeyRWLBOPFRTPFGBF-UHFFFAOYSA-N
MW208.26 g/mol
LogP2.22
Rot. Bonds4

About 4,6-dimethyl-2-(propylamino)pyridine-3-carboxylic acid

4,6-dimethyl-2-(propylamino)pyridine-3-carboxylic acid (PubChem CID 60678505) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 4,6-dimethyl-2-(propylamino)pyridine-3-carboxylic acid.

Molecular Properties

Compound Name4,6-dimethyl-2-(propylamino)pyridine-3-carboxylic acid
PubChem CID60678505
Molecular FormulaC11H16N2O2
Molecular Weight208.26 g/mol
Exact Mass208.12
IUPAC Name4,6-dimethyl-2-(propylamino)pyridine-3-carboxylic acid
SMILESCCCNc1nc(C)cc(C)c1C(=O)O
InChIInChI=1S/C11H16N2O2/c1-4-5-12-10-9(11(14)15)7(2)6-8(3)13-10/h6H,4-5H2,1-3H3,(H,12,13)(H,14,15)
InChIKeyRWLBOPFRTPFGBF-UHFFFAOYSA-N
XLogP2.22
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.26
LogP ≤ 52.22
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4,6-dimethyl-2-(propylamino)pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,6-dimethyl-2-(propylamino)pyridine-3-carboxylic acid?
The IUPAC name of 4,6-dimethyl-2-(propylamino)pyridine-3-carboxylic acid (CID 60678505) is 4,6-dimethyl-2-(propylamino)pyridine-3-carboxylic acid.
What is the SMILES notation for 4,6-dimethyl-2-(propylamino)pyridine-3-carboxylic acid?
The canonical SMILES for 4,6-dimethyl-2-(propylamino)pyridine-3-carboxylic acid is CCCNc1nc(C)cc(C)c1C(=O)O.
What is the InChIKey of 4,6-dimethyl-2-(propylamino)pyridine-3-carboxylic acid?
The InChIKey is RWLBOPFRTPFGBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2/c1-4-5-12-10-9(11(14)15)7(2)6-8(3)13-10/h6H,4-5H2,1-3H3,(H,12,13)(H,14,15).
What are the key properties of 4,6-dimethyl-2-(propylamino)pyridine-3-carboxylic acid?
4,6-dimethyl-2-(propylamino)pyridine-3-carboxylic acid has a molecular weight of 208.26 g/mol, XLogP of 2.22, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethyl-2-(propylamino)pyridine-3-carboxylic acid is sourced from PubChem (CID 60678505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).