C16H6F10N2O2 — CID 606788
2,3,4,5,6-pentafluoro-N',N'-dimethyl-N-(2,3,4,5,6-pentafluorobenzoyl)benzohydrazide (PubChem CID 606788) has the molecular formula C16H6F10N2O2 and a molecular weight of 448.22 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N',N'-dimethyl-N-(2,3,4,5,6-pentafluorobenzoyl)benzohydrazide.
| Compound Name | 2,3,4,5,6-pentafluoro-N',N'-dimethyl-N-(2,3,4,5,6-pentafluorobenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 606788 |
| Molecular Formula | C16H6F10N2O2 |
| Molecular Weight | 448.22 g/mol |
| Exact Mass | 448.03 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N',N'-dimethyl-N-(2,3,4,5,6-pentafluorobenzoyl)benzohydrazide |
| SMILES | CN(C)N(C(=O)c1c(F)c(F)c(F)c(F)c1F)C(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H6F10N2O2/c1-27(2)28(15(29)3-5(17)9(21)13(25)10(22)6(3)18)16(30)4-7(19)11(23)14(26)12(24)8(4)20/h1-2H3 |
| InChIKey | YWYJKKKLWWDVIQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.22 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|