C19H20N4O4 — CID 606794
3,4,5-trimethoxy-N-[3-(4-methyl-1,2,4-triazol-3-yl)phenyl]benzamide (PubChem CID 606794) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[3-(4-methyl-1,2,4-triazol-3-yl)phenyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[3-(4-methyl-1,2,4-triazol-3-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 606794 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 3,4,5-trimethoxy-N-[3-(4-methyl-1,2,4-triazol-3-yl)phenyl]benzamide |
| SMILES | COc1cc(C(=O)Nc2cccc(-c3nncn3C)c2)cc(OC)c1OC |
| InChI | InChI=1S/C19H20N4O4/c1-23-11-20-22-18(23)12-6-5-7-14(8-12)21-19(24)13-9-15(25-2)17(27-4)16(10-13)26-3/h5-11H,1-4H3,(H,21,24) |
| InChIKey | MFMVJLZRFANDCA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |