C16H18N2O2 — CID 60681847
ethyl 2-[[phenyl(pyridin-2-yl)methyl]amino]acetate (PubChem CID 60681847) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is ethyl 2-[[phenyl(pyridin-2-yl)methyl]amino]acetate.
| Compound Name | ethyl 2-[[phenyl(pyridin-2-yl)methyl]amino]acetate |
|---|---|
| PubChem CID | 60681847 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | ethyl 2-[[phenyl(pyridin-2-yl)methyl]amino]acetate |
| SMILES | CCOC(=O)CNC(c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C16H18N2O2/c1-2-20-15(19)12-18-16(13-8-4-3-5-9-13)14-10-6-7-11-17-14/h3-11,16,18H,2,12H2,1H3 |
| InChIKey | XKTHJRFZMFUVMH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |