About N-(2-chloroprop-2-enyl)-1,1-dioxothiolan-3-amine
N-(2-chloroprop-2-enyl)-1,1-dioxothiolan-3-amine (PubChem CID 60683242) has the molecular formula C7H12ClNO2S
and a molecular weight of 209.70 g/mol. Its IUPAC name is N-(2-chloroprop-2-enyl)-1,1-dioxothiolan-3-amine.
Molecular Properties
| Compound Name | N-(2-chloroprop-2-enyl)-1,1-dioxothiolan-3-amine |
| PubChem CID | 60683242 |
| Molecular Formula | C7H12ClNO2S |
| Molecular Weight | 209.70 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | N-(2-chloroprop-2-enyl)-1,1-dioxothiolan-3-amine |
| SMILES | C=C(Cl)CNC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H12ClNO2S/c1-6(8)4-9-7-2-3-12(10,11)5-7/h7,9H,1-5H2 |
| InChIKey | MNVNAZPDUPUNHX-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.70 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-chloroprop-2-enyl)-1,1-dioxothiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloroprop-2-enyl)-1,1-dioxothiolan-3-amine?
The IUPAC name of N-(2-chloroprop-2-enyl)-1,1-dioxothiolan-3-amine (CID 60683242) is N-(2-chloroprop-2-enyl)-1,1-dioxothiolan-3-amine.
What is the SMILES notation for N-(2-chloroprop-2-enyl)-1,1-dioxothiolan-3-amine?
The canonical SMILES for N-(2-chloroprop-2-enyl)-1,1-dioxothiolan-3-amine is C=C(Cl)CNC1CCS(=O)(=O)C1.
What is the InChIKey of N-(2-chloroprop-2-enyl)-1,1-dioxothiolan-3-amine?
The InChIKey is MNVNAZPDUPUNHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12ClNO2S/c1-6(8)4-9-7-2-3-12(10,11)5-7/h7,9H,1-5H2.
What are the key properties of N-(2-chloroprop-2-enyl)-1,1-dioxothiolan-3-amine?
N-(2-chloroprop-2-enyl)-1,1-dioxothiolan-3-amine has a molecular weight of 209.70 g/mol, XLogP of 0.52, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloroprop-2-enyl)-1,1-dioxothiolan-3-amine is sourced from PubChem (CID 60683242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).