C7H12F3NO2S — CID 60683351
1,1-dioxo-N-(3,3,3-trifluoropropyl)thiolan-3-amine (PubChem CID 60683351) has the molecular formula C7H12F3NO2S and a molecular weight of 231.24 g/mol. Its IUPAC name is 1,1-dioxo-N-(3,3,3-trifluoropropyl)thiolan-3-amine.
| Compound Name | 1,1-dioxo-N-(3,3,3-trifluoropropyl)thiolan-3-amine |
|---|---|
| PubChem CID | 60683351 |
| Molecular Formula | C7H12F3NO2S |
| Molecular Weight | 231.24 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 1,1-dioxo-N-(3,3,3-trifluoropropyl)thiolan-3-amine |
| SMILES | O=S1(=O)CCC(NCCC(F)(F)F)C1 |
| InChI | InChI=1S/C7H12F3NO2S/c8-7(9,10)2-3-11-6-1-4-14(12,13)5-6/h6,11H,1-5H2 |
| InChIKey | JGGNKLLSNQGTHV-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.24 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |