C10H16N2O — CID 60683537
N-(1,2-oxazol-5-ylmethyl)cyclohexanamine (PubChem CID 60683537) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is N-(1,2-oxazol-5-ylmethyl)cyclohexanamine.
| Compound Name | N-(1,2-oxazol-5-ylmethyl)cyclohexanamine |
|---|---|
| PubChem CID | 60683537 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | N-(1,2-oxazol-5-ylmethyl)cyclohexanamine |
| SMILES | c1cc(CNC2CCCCC2)on1 |
| InChI | InChI=1S/C10H16N2O/c1-2-4-9(5-3-1)11-8-10-6-7-12-13-10/h6-7,9,11H,1-5,8H2 |
| InChIKey | UADJHKVAIHXGSO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |