C14H20N2O4 — CID 60684179
2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-N-(1-methoxypropan-2-yl)acetamide (PubChem CID 60684179) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-N-(1-methoxypropan-2-yl)acetamide.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-N-(1-methoxypropan-2-yl)acetamide |
|---|---|
| PubChem CID | 60684179 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-N-(1-methoxypropan-2-yl)acetamide |
| SMILES | COCC(C)NC(=O)CNc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C14H20N2O4/c1-10(9-18-2)16-14(17)8-15-11-3-4-12-13(7-11)20-6-5-19-12/h3-4,7,10,15H,5-6,8-9H2,1-2H3,(H,16,17) |
| InChIKey | LCAOTEBOWSRJLQ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|