C13H22O2 — CID 606866
4-(2,6,6-trimethylcyclohexen-1-yl)butanoic acid (PubChem CID 606866) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is 4-(2,6,6-trimethylcyclohexen-1-yl)butanoic acid.
| Compound Name | 4-(2,6,6-trimethylcyclohexen-1-yl)butanoic acid |
|---|---|
| PubChem CID | 606866 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 4-(2,6,6-trimethylcyclohexen-1-yl)butanoic acid |
| SMILES | CC1=C(CCCC(=O)O)C(C)(C)CCC1 |
| InChI | InChI=1S/C13H22O2/c1-10-6-5-9-13(2,3)11(10)7-4-8-12(14)15/h4-9H2,1-3H3,(H,14,15) |
| InChIKey | BGADGHSOFNIDPF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|