C11H24N2O3 — CID 60686797
2-[bis(2-hydroxyethyl)amino]-N-tert-butylpropanamide (PubChem CID 60686797) has the molecular formula C11H24N2O3 and a molecular weight of 232.32 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]-N-tert-butylpropanamide.
| Compound Name | 2-[bis(2-hydroxyethyl)amino]-N-tert-butylpropanamide |
|---|---|
| PubChem CID | 60686797 |
| Molecular Formula | C11H24N2O3 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]-N-tert-butylpropanamide |
| SMILES | CC(C(=O)NC(C)(C)C)N(CCO)CCO |
| InChI | InChI=1S/C11H24N2O3/c1-9(10(16)12-11(2,3)4)13(5-7-14)6-8-15/h9,14-15H,5-8H2,1-4H3,(H,12,16) |
| InChIKey | LEGYRCAULXZDQN-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |