C12H23N3O4 — CID 60687680
ethyl 4-[[2-(2-acetamidoethylamino)-2-oxoethyl]amino]butanoate (PubChem CID 60687680) has the molecular formula C12H23N3O4 and a molecular weight of 273.33 g/mol. Its IUPAC name is ethyl 4-[[2-(2-acetamidoethylamino)-2-oxoethyl]amino]butanoate.
| Compound Name | ethyl 4-[[2-(2-acetamidoethylamino)-2-oxoethyl]amino]butanoate |
|---|---|
| PubChem CID | 60687680 |
| Molecular Formula | C12H23N3O4 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | ethyl 4-[[2-(2-acetamidoethylamino)-2-oxoethyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNCC(=O)NCCNC(C)=O |
| InChI | InChI=1S/C12H23N3O4/c1-3-19-12(18)5-4-6-13-9-11(17)15-8-7-14-10(2)16/h13H,3-9H2,1-2H3,(H,14,16)(H,15,17) |
| InChIKey | FGLGJNRQGYVAPQ-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|