About 2-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl-butylamino]ethanol
2-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl-butylamino]ethanol (PubChem CID 60689002) has the molecular formula C15H20BrN3O2
and a molecular weight of 354.25 g/mol. Its IUPAC name is 2-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl-butylamino]ethanol.
Molecular Properties
| Compound Name | 2-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl-butylamino]ethanol |
| PubChem CID | 60689002 |
| Molecular Formula | C15H20BrN3O2 |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 2-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl-butylamino]ethanol |
| SMILES | CCCCN(CCO)Cc1nnc(-c2ccccc2Br)o1 |
| InChI | InChI=1S/C15H20BrN3O2/c1-2-3-8-19(9-10-20)11-14-17-18-15(21-14)12-6-4-5-7-13(12)16/h4-7,20H,2-3,8-11H2,1H3 |
| InChIKey | NSKUPFUPMWRFDN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl-butylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl-butylamino]ethanol?
The IUPAC name of 2-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl-butylamino]ethanol (CID 60689002) is 2-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl-butylamino]ethanol.
What is the SMILES notation for 2-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl-butylamino]ethanol?
The canonical SMILES for 2-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl-butylamino]ethanol is CCCCN(CCO)Cc1nnc(-c2ccccc2Br)o1.
What is the InChIKey of 2-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl-butylamino]ethanol?
The InChIKey is NSKUPFUPMWRFDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20BrN3O2/c1-2-3-8-19(9-10-20)11-14-17-18-15(21-14)12-6-4-5-7-13(12)16/h4-7,20H,2-3,8-11H2,1H3.
What are the key properties of 2-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl-butylamino]ethanol?
2-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl-butylamino]ethanol has a molecular weight of 354.25 g/mol, XLogP of 3.09, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl-butylamino]ethanol is sourced from PubChem (CID 60689002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).